C11H14FN — CID 83914941
3-ethyl-6-fluoro-2-methyl-2,3-dihydro-1H-indole (PubChem CID 83914941) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-ethyl-6-fluoro-2-methyl-2,3-dihydro-1H-indole.
| Compound Name | 3-ethyl-6-fluoro-2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 83914941 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-ethyl-6-fluoro-2-methyl-2,3-dihydro-1H-indole |
| SMILES | CCC1c2ccc(F)cc2NC1C |
| InChI | InChI=1S/C11H14FN/c1-3-9-7(2)13-11-6-8(12)4-5-10(9)11/h4-7,9,13H,3H2,1-2H3 |
| InChIKey | FMYRTVPCMPMQCF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |