C11H15N — CID 95970001
(2R,3S)-3-ethyl-2-methyl-2,3-dihydro-1H-indole (PubChem CID 95970001) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (2R,3S)-3-ethyl-2-methyl-2,3-dihydro-1H-indole.
| Compound Name | (2R,3S)-3-ethyl-2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 95970001 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2R,3S)-3-ethyl-2-methyl-2,3-dihydro-1H-indole |
| SMILES | CC[C@H]1c2ccccc2N[C@@H]1C |
| InChI | InChI=1S/C11H15N/c1-3-9-8(2)12-11-7-5-4-6-10(9)11/h4-9,12H,3H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | YQTHBLHVUIPAEY-RKDXNWHRSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |