C12H17NO — CID 131014008
(2S,4R)-4-ethoxy-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 131014008) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2S,4R)-4-ethoxy-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,4R)-4-ethoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 131014008 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2S,4R)-4-ethoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCO[C@@H]1C[C@H](C)Nc2ccccc21 |
| InChI | InChI=1S/C12H17NO/c1-3-14-12-8-9(2)13-11-7-5-4-6-10(11)12/h4-7,9,12-13H,3,8H2,1-2H3/t9-,12+/m0/s1 |
| InChIKey | STTSTBKEXQBPCI-JOYOIKCWSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |