C11H14ClN — CID 83915776
6-chloro-3-ethyl-2-methyl-2,3-dihydro-1H-indole (PubChem CID 83915776) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is 6-chloro-3-ethyl-2-methyl-2,3-dihydro-1H-indole.
| Compound Name | 6-chloro-3-ethyl-2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 83915776 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-chloro-3-ethyl-2-methyl-2,3-dihydro-1H-indole |
| SMILES | CCC1c2ccc(Cl)cc2NC1C |
| InChI | InChI=1S/C11H14ClN/c1-3-9-7(2)13-11-6-8(12)4-5-10(9)11/h4-7,9,13H,3H2,1-2H3 |
| InChIKey | OAPRECQDHZQRIO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |