About 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid
6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 83915741) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid.
Analyze 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
The IUPAC name of 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid (CID 83915741) is 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid.
What is the SMILES notation for 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
The canonical SMILES for 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid is CC1c2ccc(F)cc2NC1C(=O)O.
What is the InChIKey of 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
The InChIKey is XSHJMMXLRJCVLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c1-5-7-3-2-6(11)4-8(7)12-9(5)10(13)14/h2-5,9,12H,1H3,(H,13,14).
What are the key properties of 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid has a molecular weight of 195.19 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid is sourced from PubChem (CID 83915741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).