C12H15F — CID 126625151
3-ethyl-5-fluoro-1-methyl-2,3-dihydro-1H-indene (PubChem CID 126625151) has the molecular formula C12H15F and a molecular weight of 178.25 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-1-methyl-2,3-dihydro-1H-indene.
| Compound Name | 3-ethyl-5-fluoro-1-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 126625151 |
| Molecular Formula | C12H15F |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 3-ethyl-5-fluoro-1-methyl-2,3-dihydro-1H-indene |
| SMILES | CCC1CC(C)c2ccc(F)cc21 |
| InChI | InChI=1S/C12H15F/c1-3-9-6-8(2)11-5-4-10(13)7-12(9)11/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | RYBCVLQRQCHRMG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |