C12H16O2 — CID 14967720
(6-methoxy-3-methyl-2,3-dihydro-1H-inden-1-yl)methanol (PubChem CID 14967720) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (6-methoxy-3-methyl-2,3-dihydro-1H-inden-1-yl)methanol.
| Compound Name | (6-methoxy-3-methyl-2,3-dihydro-1H-inden-1-yl)methanol |
|---|---|
| PubChem CID | 14967720 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (6-methoxy-3-methyl-2,3-dihydro-1H-inden-1-yl)methanol |
| SMILES | COc1ccc2c(c1)C(CO)CC2C |
| InChI | InChI=1S/C12H16O2/c1-8-5-9(7-13)12-6-10(14-2)3-4-11(8)12/h3-4,6,8-9,13H,5,7H2,1-2H3 |
| InChIKey | NREIKOOKOCMACI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |