C21H20O4 — CID 162406258
12-(hydroxymethyl)-8,16-dimethoxypentacyclo[12.4.0.02,4.05,10.011,13]octadeca-1(14),5(10),6,8,15,17-hexaen-3-one (PubChem CID 162406258) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 12-(hydroxymethyl)-8,16-dimethoxypentacyclo[12.4.0.02,4.05,10.011,13]octadeca-1(14),5(10),6,8,15,17-hexaen-3-one.
| Compound Name | 12-(hydroxymethyl)-8,16-dimethoxypentacyclo[12.4.0.02,4.05,10.011,13]octadeca-1(14),5(10),6,8,15,17-hexaen-3-one |
|---|---|
| PubChem CID | 162406258 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 12-(hydroxymethyl)-8,16-dimethoxypentacyclo[12.4.0.02,4.05,10.011,13]octadeca-1(14),5(10),6,8,15,17-hexaen-3-one |
| SMILES | COc1ccc2c(c1)C1C(CO)C1c1cc(OC)ccc1C1C(=O)C21 |
| InChI | InChI=1S/C21H20O4/c1-24-10-3-5-12-14(7-10)17-16(9-22)18(17)15-8-11(25-2)4-6-13(15)20-19(12)21(20)23/h3-8,16-20,22H,9H2,1-2H3 |
| InChIKey | GPBQUZUJCMPHDQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |