About 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one
2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one (PubChem CID 56637248) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one |
| PubChem CID | 56637248 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one |
| SMILES | COc1ccc(C2C(=O)C2c2ccc(C)cc2C)c(OC)c1 |
| InChI | InChI=1S/C19H20O3/c1-11-5-7-14(12(2)9-11)17-18(19(17)20)15-8-6-13(21-3)10-16(15)22-4/h5-10,17-18H,1-4H3 |
| InChIKey | FRDQFLFEMYYHHF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one (CID 56637248) is 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one is COc1ccc(C2C(=O)C2c2ccc(C)cc2C)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one?
The InChIKey is FRDQFLFEMYYHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O3/c1-11-5-7-14(12(2)9-11)17-18(19(17)20)15-8-6-13(21-3)10-16(15)22-4/h5-10,17-18H,1-4H3.
What are the key properties of 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one?
2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one has a molecular weight of 296.37 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)cyclopropan-1-one is sourced from PubChem (CID 56637248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).