C9H10O2 — CID 13159350
3-methoxy-6-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 13159350) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methoxy-6-methylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 3-methoxy-6-methylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 13159350 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3-methoxy-6-methylcyclohepta-2,4,6-trien-1-one |
| SMILES | COc1ccc(C)cc(=O)c1 |
| InChI | InChI=1S/C9H10O2/c1-7-3-4-9(11-2)6-8(10)5-7/h3-6H,1-2H3 |
| InChIKey | IMOWDNBBECSYQH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |