C13H10O5 — CID 125492900
(1S,8S,9R,13R)-4-methoxy-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2(7),3,5-triene-10,12-dione (PubChem CID 125492900) has the molecular formula C13H10O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is (1S,8S,9R,13R)-4-methoxy-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2(7),3,5-triene-10,12-dione.
| Compound Name | (1S,8S,9R,13R)-4-methoxy-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2(7),3,5-triene-10,12-dione |
|---|---|
| PubChem CID | 125492900 |
| Molecular Formula | C13H10O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (1S,8S,9R,13R)-4-methoxy-11,14-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2(7),3,5-triene-10,12-dione |
| SMILES | COc1ccc2c(c1)[C@H]1O[C@H]2[C@@H]2C(=O)OC(=O)[C@H]21 |
| InChI | InChI=1S/C13H10O5/c1-16-5-2-3-6-7(4-5)11-9-8(10(6)17-11)12(14)18-13(9)15/h2-4,8-11H,1H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | LUOMIGCTFGQRJK-GWOFURMSSA-N |
| XLogP | 1.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|