C16H12O3S — CID 10636790
(6aS,11aS)-3-methoxy-6a,11a-dihydro-[1]benzothiolo[3,2-c]chromen-6-one (PubChem CID 10636790) has the molecular formula C16H12O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is (6aS,11aS)-3-methoxy-6a,11a-dihydro-[1]benzothiolo[3,2-c]chromen-6-one.
| Compound Name | (6aS,11aS)-3-methoxy-6a,11a-dihydro-[1]benzothiolo[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 10636790 |
| Molecular Formula | C16H12O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (6aS,11aS)-3-methoxy-6a,11a-dihydro-[1]benzothiolo[3,2-c]chromen-6-one |
| SMILES | COc1ccc2c(c1)OC(=O)[C@@H]1c3ccccc3S[C@H]21 |
| InChI | InChI=1S/C16H12O3S/c1-18-9-6-7-10-12(8-9)19-16(17)14-11-4-2-3-5-13(11)20-15(10)14/h2-8,14-15H,1H3/t14-,15-/m1/s1 |
| InChIKey | IMVLDUFRAZEEQF-HUUCEWRRSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|