C29H24O4 — CID 134938886
(3R,4S)-7-methoxy-3-phenyl-4-(4-phenylmethoxyphenyl)-3,4-dihydrochromen-2-one (PubChem CID 134938886) has the molecular formula C29H24O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (3R,4S)-7-methoxy-3-phenyl-4-(4-phenylmethoxyphenyl)-3,4-dihydrochromen-2-one.
| Compound Name | (3R,4S)-7-methoxy-3-phenyl-4-(4-phenylmethoxyphenyl)-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 134938886 |
| Molecular Formula | C29H24O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (3R,4S)-7-methoxy-3-phenyl-4-(4-phenylmethoxyphenyl)-3,4-dihydrochromen-2-one |
| SMILES | COc1ccc2c(c1)OC(=O)[C@@H](c1ccccc1)[C@H]2c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H24O4/c1-31-24-16-17-25-26(18-24)33-29(30)28(21-10-6-3-7-11-21)27(25)22-12-14-23(15-13-22)32-19-20-8-4-2-5-9-20/h2-18,27-28H,19H2,1H3/t27-,28-/m0/s1 |
| InChIKey | YUMAEMRTORRDQN-NSOVKSMOSA-N |
| XLogP | 6.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|