C30H30O5 — CID 75253352
tert-butyl 3-[4-[(7-methoxy-2-oxo-3-phenyl-3,4-dihydrochromen-4-yl)methyl]phenyl]prop-2-enoate (PubChem CID 75253352) has the molecular formula C30H30O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is tert-butyl 3-[4-[(7-methoxy-2-oxo-3-phenyl-3,4-dihydrochromen-4-yl)methyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[(7-methoxy-2-oxo-3-phenyl-3,4-dihydrochromen-4-yl)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 75253352 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | tert-butyl 3-[4-[(7-methoxy-2-oxo-3-phenyl-3,4-dihydrochromen-4-yl)methyl]phenyl]prop-2-enoate |
| SMILES | COc1ccc2c(c1)OC(=O)C(c1ccccc1)C2Cc1ccc(C=CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H30O5/c1-30(2,3)35-27(31)17-14-20-10-12-21(13-11-20)18-25-24-16-15-23(33-4)19-26(24)34-29(32)28(25)22-8-6-5-7-9-22/h5-17,19,25,28H,18H2,1-4H3 |
| InChIKey | NFXZZWVVJXJRMK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|