C23H23NO5 — CID 73212377
tert-butyl (E)-3-[1-[(4-methoxyphenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate (PubChem CID 73212377) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl (E)-3-[1-[(4-methoxyphenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[1-[(4-methoxyphenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 73212377 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | tert-butyl (E)-3-[1-[(4-methoxyphenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate |
| SMILES | COc1ccc(CN2C(=O)C(=O)c3cc(/C=C/C(=O)OC(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-23(2,3)29-20(25)12-8-15-7-11-19-18(13-15)21(26)22(27)24(19)14-16-5-9-17(28-4)10-6-16/h5-13H,14H2,1-4H3/b12-8+ |
| InChIKey | ADPPKSKOGUFMGH-XYOKQWHBSA-N |
| XLogP | 3.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|