C22H20BrNO4 — CID 73212376
butyl (E)-3-[1-[(4-bromophenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate (PubChem CID 73212376) has the molecular formula C22H20BrNO4 and a molecular weight of 442.31 g/mol. Its IUPAC name is butyl (E)-3-[1-[(4-bromophenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate.
| Compound Name | butyl (E)-3-[1-[(4-bromophenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 73212376 |
| Molecular Formula | C22H20BrNO4 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | butyl (E)-3-[1-[(4-bromophenyl)methyl]-2,3-dioxoindol-5-yl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrNO4/c1-2-3-12-28-20(25)11-7-15-6-10-19-18(13-15)21(26)22(27)24(19)14-16-4-8-17(23)9-5-16/h4-11,13H,2-3,12,14H2,1H3/b11-7+ |
| InChIKey | SLJMOTSCMLZQOW-YRNVUSSQSA-N |
| XLogP | 4.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|