C22H16BrNO3 — CID 141372263
1-[(4-bromophenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione (PubChem CID 141372263) has the molecular formula C22H16BrNO3 and a molecular weight of 422.28 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione.
| Compound Name | 1-[(4-bromophenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione |
|---|---|
| PubChem CID | 141372263 |
| Molecular Formula | C22H16BrNO3 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)C(=O)N3Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H16BrNO3/c1-27-18-9-4-15(5-10-18)16-6-11-20-19(12-16)21(25)22(26)24(20)13-14-2-7-17(23)8-3-14/h2-12H,13H2,1H3 |
| InChIKey | NUAMVJIXZFIQKX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|