C23H16F3NO3 — CID 141372246
1-[(4-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]indole-2,3-dione (PubChem CID 141372246) has the molecular formula C23H16F3NO3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]indole-2,3-dione.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]indole-2,3-dione |
|---|---|
| PubChem CID | 141372246 |
| Molecular Formula | C23H16F3NO3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-5-[4-(trifluoromethyl)phenyl]indole-2,3-dione |
| SMILES | COc1ccc(CN2C(=O)C(=O)c3cc(-c4ccc(C(F)(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C23H16F3NO3/c1-30-18-9-2-14(3-10-18)13-27-20-11-6-16(12-19(20)21(28)22(27)29)15-4-7-17(8-5-15)23(24,25)26/h2-12H,13H2,1H3 |
| InChIKey | RKCYEFAWSDGUSD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|