C24H21NO3 — CID 141372231
1-[(3,5-dimethylphenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione (PubChem CID 141372231) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione.
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione |
|---|---|
| PubChem CID | 141372231 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]-5-(4-methoxyphenyl)indole-2,3-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)C(=O)N3Cc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C24H21NO3/c1-15-10-16(2)12-17(11-15)14-25-22-9-6-19(13-21(22)23(26)24(25)27)18-4-7-20(28-3)8-5-18/h4-13H,14H2,1-3H3 |
| InChIKey | WGAZGFBNEIQNOH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|