C46H42O6 — CID 102036173
(4bS,5S,9bS,10S)-2,3,7,8-tetramethoxy-5,10-bis(4-phenylmethoxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene (PubChem CID 102036173) has the molecular formula C46H42O6 and a molecular weight of 690.84 g/mol. Its IUPAC name is (4bS,5S,9bS,10S)-2,3,7,8-tetramethoxy-5,10-bis(4-phenylmethoxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene.
| Compound Name | (4bS,5S,9bS,10S)-2,3,7,8-tetramethoxy-5,10-bis(4-phenylmethoxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene |
|---|---|
| PubChem CID | 102036173 |
| Molecular Formula | C46H42O6 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | (4bS,5S,9bS,10S)-2,3,7,8-tetramethoxy-5,10-bis(4-phenylmethoxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene |
| SMILES | COc1cc2c(cc1OC)[C@@H]1[C@@H](c3ccc(OCc4ccccc4)cc3)c3cc(OC)c(OC)cc3[C@@H]1[C@H]2c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C46H42O6/c1-47-39-23-35-37(25-41(39)49-3)45-44(32-17-21-34(22-18-32)52-28-30-13-9-6-10-14-30)36-24-40(48-2)42(50-4)26-38(36)46(45)43(35)31-15-19-33(20-16-31)51-27-29-11-7-5-8-12-29/h5-26,43-46H,27-28H2,1-4H3/t43-,44-,45+,46+/m0/s1 |
| InChIKey | SIBBRQNWCPBEJF-LZCGGXSTSA-N |
| XLogP | 10.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |