C24H18O4 — CID 10785381
(1R,2S,3S,6R,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione (PubChem CID 10785381) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is (1R,2S,3S,6R,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione.
| Compound Name | (1R,2S,3S,6R,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione |
|---|---|
| PubChem CID | 10785381 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (1R,2S,3S,6R,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.13,6.02,7.09,14.015,20]tetracosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione |
| SMILES | COc1ccc2c(c1)[C@@H]1c3ccccc3[C@H]2[C@]23C(=O)OC(=O)[C@]12[C@H]1C=C[C@@H]3C1 |
| InChI | InChI=1S/C24H18O4/c1-27-14-8-9-17-18(11-14)20-16-5-3-2-4-15(16)19(17)23-12-6-7-13(10-12)24(20,23)22(26)28-21(23)25/h2-9,11-13,19-20H,10H2,1H3/t12-,13+,19-,20+,23-,24+/m1/s1 |
| InChIKey | UQOAYRLWKBFMCY-APNJOQKZSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|