C12H10Cl2O2 — CID 10106484
(2aS,7aS)-2,2-dichloro-4-methoxy-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one (PubChem CID 10106484) has the molecular formula C12H10Cl2O2 and a molecular weight of 257.12 g/mol. Its IUPAC name is (2aS,7aS)-2,2-dichloro-4-methoxy-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one.
| Compound Name | (2aS,7aS)-2,2-dichloro-4-methoxy-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one |
|---|---|
| PubChem CID | 10106484 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (2aS,7aS)-2,2-dichloro-4-methoxy-7,7a-dihydro-2aH-cyclobuta[a]inden-1-one |
| SMILES | COc1ccc2c(c1)[C@@H]1[C@H](C2)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C12H10Cl2O2/c1-16-7-3-2-6-4-9-10(8(6)5-7)12(13,14)11(9)15/h2-3,5,9-10H,4H2,1H3/t9-,10+/m0/s1 |
| InChIKey | PVKPKJHDCWKUNC-VHSXEESVSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|