C13H17NO — CID 58294510
(9aS)-6-methoxy-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine (PubChem CID 58294510) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (9aS)-6-methoxy-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine.
| Compound Name | (9aS)-6-methoxy-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 58294510 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (9aS)-6-methoxy-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine |
| SMILES | COc1ccc2c(c1)C1CCCN[C@H]1C2 |
| InChI | InChI=1S/C13H17NO/c1-15-10-5-4-9-7-13-11(12(9)8-10)3-2-6-14-13/h4-5,8,11,13-14H,2-3,6-7H2,1H3/t11?,13-/m0/s1 |
| InChIKey | QDQSCYPTBGSQBP-YUZLPWPTSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |