C17H21N — CID 67224046
6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine (PubChem CID 67224046) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine.
| Compound Name | 6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 67224046 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 6-(cyclopenten-1-yl)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridine |
| SMILES | C1=C(c2ccc3c(c2)C2CCCNC2C3)CCC1 |
| InChI | InChI=1S/C17H21N/c1-2-5-12(4-1)13-7-8-14-11-17-15(16(14)10-13)6-3-9-18-17/h4,7-8,10,15,17-18H,1-3,5-6,9,11H2 |
| InChIKey | KCJYGNALSCTFOW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |