C14H18N2 — CID 123299289
2,3,4,6,6a,7,8,9,10,10a-decahydroindolo[4,3-fg]quinoline (PubChem CID 123299289) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,3,4,6,6a,7,8,9,10,10a-decahydroindolo[4,3-fg]quinoline.
| Compound Name | 2,3,4,6,6a,7,8,9,10,10a-decahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 123299289 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2,3,4,6,6a,7,8,9,10,10a-decahydroindolo[4,3-fg]quinoline |
| SMILES | C1=C2c3c(c[nH]c3CC1)CC1NCCCC21 |
| InChI | InChI=1S/C14H18N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h3,8,10,13,15-16H,1-2,4-7H2 |
| InChIKey | QSCSIBGIVUEZHY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |