C16H24N4 — CID 175449167
(6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline;ethane-1,2-diamine (PubChem CID 175449167) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline;ethane-1,2-diamine.
| Compound Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline;ethane-1,2-diamine |
|---|---|
| PubChem CID | 175449167 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline;ethane-1,2-diamine |
| SMILES | NCCN.c1cc2c3c(c[nH]c3c1)C[C@H]1NCCC[C@H]21 |
| InChI | InChI=1S/C14H16N2.C2H8N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11;3-1-2-4/h1,3,5,8,10,13,15-16H,2,4,6-7H2;1-4H2/t10-,13-;/m1./s1 |
| InChIKey | GOHZFSCDAKPMGR-HTMVYDOJSA-N |
| XLogP | 1.46 |
| TPSA | 79.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |