C16H20N2O — CID 67571263
(6aR)-5-ethoxy-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (PubChem CID 67571263) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (6aR)-5-ethoxy-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aR)-5-ethoxy-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 67571263 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (6aR)-5-ethoxy-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
| SMILES | CCOc1[nH]c2cccc3c2c1C[C@H]1NCCCC31 |
| InChI | InChI=1S/C16H20N2O/c1-2-19-16-12-9-14-10(6-4-8-17-14)11-5-3-7-13(18-16)15(11)12/h3,5,7,10,14,17-18H,2,4,6,8-9H2,1H3/t10?,14-/m1/s1 |
| InChIKey | OMUADAKSKBKVPH-LNUXAPHWSA-N |
| XLogP | 2.96 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |