C14H16N2O2 — CID 57174499
(6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5,9-diol (PubChem CID 57174499) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5,9-diol.
| Compound Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5,9-diol |
|---|---|
| PubChem CID | 57174499 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5,9-diol |
| SMILES | Oc1[nH]c2cccc3c2c1C[C@H]1NCC(O)C[C@H]31 |
| InChI | InChI=1S/C14H16N2O2/c17-7-4-9-8-2-1-3-11-13(8)10(14(18)16-11)5-12(9)15-6-7/h1-3,7,9,12,15-18H,4-6H2/t7?,9-,12-/m1/s1 |
| InChIKey | LMJOTCKSWHMSQJ-XTOKZYMASA-N |
| XLogP | 1.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |