C18H18N4 — CID 70573336
(6aR,10aR)-9-pyridazin-3-yl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (PubChem CID 70573336) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is (6aR,10aR)-9-pyridazin-3-yl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline.
| Compound Name | (6aR,10aR)-9-pyridazin-3-yl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 70573336 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (6aR,10aR)-9-pyridazin-3-yl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
| SMILES | c1cnnc(C2CN[C@@H]3Cc4c[nH]c5cccc(c45)[C@H]3C2)c1 |
| InChI | InChI=1S/C18H18N4/c1-3-13-14-7-11(15-5-2-6-21-22-15)9-20-17(14)8-12-10-19-16(4-1)18(12)13/h1-6,10-11,14,17,19-20H,7-9H2/t11?,14-,17-/m1/s1 |
| InChIKey | JHUGDJMJRBNYHG-GFADCJBXSA-N |
| XLogP | 2.74 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |