C29H25N5O — CID 23616047
(6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide;indolo[4,3-fg]quinoline (PubChem CID 23616047) has the molecular formula C29H25N5O and a molecular weight of 459.55 g/mol. Its IUPAC name is (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide;indolo[4,3-fg]quinoline.
| Compound Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide;indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 23616047 |
| Molecular Formula | C29H25N5O |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide;indolo[4,3-fg]quinoline |
| SMILES | C1=Nc2cccc3c2c1cc1ncccc13.NC(=O)C1CN[C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2C1 |
| InChI | InChI=1S/C15H17N3O.C14H8N2/c16-15(19)9-4-11-10-2-1-3-12-14(10)8(6-17-12)5-13(11)18-7-9;1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1-3,6,9,11,13,17-18H,4-5,7H2,(H2,16,19);1-8H/t9?,11-,13-;/m1./s1 |
| InChIKey | VRJQRSJOUAGIFC-DIINGDELSA-N |
| XLogP | 4.72 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|