C20H25N3O5 — CID 70365507
(6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;butanedioic acid (PubChem CID 70365507) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is (6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;butanedioic acid.
| Compound Name | (6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;butanedioic acid |
|---|---|
| PubChem CID | 70365507 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (6aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide;butanedioic acid |
| SMILES | CN1CC(C(N)=O)CC2c3cccc4[nH]cc(c34)C[C@H]21.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C16H19N3O.C4H6O4/c1-19-8-10(16(17)20)5-12-11-3-2-4-13-15(11)9(7-18-13)6-14(12)19;5-3(6)1-2-4(7)8/h2-4,7,10,12,14,18H,5-6,8H2,1H3,(H2,17,20);1-2H2,(H,5,6)(H,7,8)/t10?,12?,14-;/m1./s1 |
| InChIKey | RSCDMCVWMPWDOY-XSQZMJFISA-N |
| XLogP | 1.55 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |