C15H19N3 — CID 70167957
[(6aR,9S,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methanamine (PubChem CID 70167957) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is [(6aR,9S,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methanamine.
| Compound Name | [(6aR,9S,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methanamine |
|---|---|
| PubChem CID | 70167957 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | [(6aR,9S,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methanamine |
| SMILES | NC[C@H]1CN[C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2C1 |
| InChI | InChI=1S/C15H19N3/c16-6-9-4-12-11-2-1-3-13-15(11)10(8-18-13)5-14(12)17-7-9/h1-3,8-9,12,14,17-18H,4-7,16H2/t9-,12+,14+/m0/s1 |
| InChIKey | ODTCIYCTILPXFR-MRCXROJRSA-N |
| XLogP | 1.74 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |