C17H22N2OS — CID 90128946
2-[[(9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methylsulfanyl]ethanol (PubChem CID 90128946) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[[(9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methylsulfanyl]ethanol.
| Compound Name | 2-[[(9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 90128946 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[[(9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methylsulfanyl]ethanol |
| SMILES | OCCSC[C@H]1CNC2Cc3c[nH]c4cccc(c34)[C@H]2C1 |
| InChI | InChI=1S/C17H22N2OS/c20-4-5-21-10-11-6-14-13-2-1-3-15-17(13)12(9-19-15)7-16(14)18-8-11/h1-3,9,11,14,16,18-20H,4-8,10H2/t11-,14-,16?/m1/s1 |
| InChIKey | UDXSWRLWIWZGEQ-FPZHHAFBSA-N |
| XLogP | 2.51 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|