C14H17N3 — CID 57294554
(6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-amine (PubChem CID 57294554) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-amine.
| Compound Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-amine |
|---|---|
| PubChem CID | 57294554 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-amine |
| SMILES | NC1CN[C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2C1 |
| InChI | InChI=1S/C14H17N3/c15-9-5-11-10-2-1-3-12-14(10)8(6-16-12)4-13(11)17-7-9/h1-3,6,9,11,13,16-17H,4-5,7,15H2/t9?,11-,13-/m1/s1 |
| InChIKey | JHWDWUPYEQIICX-HRBVQNPCSA-N |
| XLogP | 1.50 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |