C18H25N3 — CID 13060633
[(6aR,9S,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanamine (PubChem CID 13060633) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is [(6aR,9S,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanamine.
| Compound Name | [(6aR,9S,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanamine |
|---|---|
| PubChem CID | 13060633 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | [(6aR,9S,10aR)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanamine |
| SMILES | CCCN1C[C@H](CN)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C18H25N3/c1-2-6-21-11-12(9-19)7-15-14-4-3-5-16-18(14)13(10-20-16)8-17(15)21/h3-5,10,12,15,17,20H,2,6-9,11,19H2,1H3/t12-,15+,17+/m0/s1 |
| InChIKey | HLJIHLIMNRWKRY-XGWLTEMNSA-N |
| XLogP | 2.87 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |