C22H28N4O2 — CID 11794185
4-[[(6aR,9S,10aS)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]piperazine-2,6-dione (PubChem CID 11794185) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-[[(6aR,9S,10aS)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]piperazine-2,6-dione.
| Compound Name | 4-[[(6aR,9S,10aS)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 11794185 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-[[(6aR,9S,10aS)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]piperazine-2,6-dione |
| SMILES | CCCN1C[C@H](CN2CC(=O)NC(=O)C2)C[C@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C22H28N4O2/c1-2-6-26-11-14(10-25-12-20(27)24-21(28)13-25)7-17-16-4-3-5-18-22(16)15(9-23-18)8-19(17)26/h3-5,9,14,17,19,23H,2,6-8,10-13H2,1H3,(H,24,27,28)/t14-,17-,19+/m0/s1 |
| InChIKey | YKWHQNPOWQMYAK-UCLAIMLFSA-N |
| XLogP | 1.87 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|