C16H21N3 — CID 14277600
(6aR,9S,10aR)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine (PubChem CID 14277600) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (6aR,9S,10aR)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine.
| Compound Name | (6aR,9S,10aR)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine |
|---|---|
| PubChem CID | 14277600 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (6aR,9S,10aR)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-amine |
| SMILES | Cc1[nH]c2cccc3c2c1C[C@@H]1[C@@H]3C[C@H](N)CN1C |
| InChI | InChI=1S/C16H21N3/c1-9-12-7-15-13(6-10(17)8-19(15)2)11-4-3-5-14(18-9)16(11)12/h3-5,10,13,15,18H,6-8,17H2,1-2H3/t10-,13+,15+/m0/s1 |
| InChIKey | RKZACOKFBAFYPQ-PSOPSSQASA-N |
| XLogP | 2.15 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |