C20H28N2O — CID 18652439
(6aR,9R)-9-(methoxymethyl)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 18652439) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (6aR,9R)-9-(methoxymethyl)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,9R)-9-(methoxymethyl)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 18652439 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (6aR,9R)-9-(methoxymethyl)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CCCN1C[C@H](COC)CC2c3cccc4[nH]c(C)c(c34)C[C@H]21 |
| InChI | InChI=1S/C20H28N2O/c1-4-8-22-11-14(12-23-3)9-17-15-6-5-7-18-20(15)16(10-19(17)22)13(2)21-18/h5-7,14,17,19,21H,4,8-12H2,1-3H3/t14-,17?,19-/m1/s1 |
| InChIKey | OEHFEDGXCPOHCU-LJMFKLJISA-N |
| XLogP | 3.86 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |