C23H31ClN2O5 — CID 70042103
(6aR,9R,10aR)-5-chloro-9-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;butanedioic acid (PubChem CID 70042103) has the molecular formula C23H31ClN2O5 and a molecular weight of 450.96 g/mol. Its IUPAC name is (6aR,9R,10aR)-5-chloro-9-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;butanedioic acid.
| Compound Name | (6aR,9R,10aR)-5-chloro-9-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;butanedioic acid |
|---|---|
| PubChem CID | 70042103 |
| Molecular Formula | C23H31ClN2O5 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (6aR,9R,10aR)-5-chloro-9-(methoxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline;butanedioic acid |
| SMILES | CCCN1C[C@H](COC)C[C@@H]2c3cccc4[nH]c(Cl)c(c34)C[C@H]21.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C19H25ClN2O.C4H6O4/c1-3-7-22-10-12(11-23-2)8-14-13-5-4-6-16-18(13)15(9-17(14)22)19(20)21-16;5-3(6)1-2-4(7)8/h4-6,12,14,17,21H,3,7-11H2,1-2H3;1-2H2,(H,5,6)(H,7,8)/t12-,14-,17-;/m1./s1 |
| InChIKey | WBCALLMOSSNHDV-YCLOEFEOSA-N |
| XLogP | 4.14 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |