C20H26N2O3 — CID 67885467
methyl (6aR,9R,10aR)-5-(hydroxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 67885467) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl (6aR,9R,10aR)-5-(hydroxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | methyl (6aR,9R,10aR)-5-(hydroxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 67885467 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl (6aR,9R,10aR)-5-(hydroxymethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | CCCN1C[C@H](C(=O)OC)C[C@@H]2c3cccc4[nH]c(CO)c(c34)C[C@H]21 |
| InChI | InChI=1S/C20H26N2O3/c1-3-7-22-10-12(20(24)25-2)8-14-13-5-4-6-16-19(13)15(9-18(14)22)17(11-23)21-16/h4-6,12,14,18,21,23H,3,7-11H2,1-2H3/t12-,14-,18-/m1/s1 |
| InChIKey | FSWUPRNIFNPCPI-RVZJWNSFSA-N |
| XLogP | 2.57 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |