C19H24N2O2 — CID 57121188
methyl (6aR,9S)-7-ethyl-5-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 57121188) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (6aR,9S)-7-ethyl-5-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | methyl (6aR,9S)-7-ethyl-5-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 57121188 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | methyl (6aR,9S)-7-ethyl-5-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | CCN1C[C@@H](C(=O)OC)CC2c3cccc4[nH]c(C)c(c34)C[C@H]21 |
| InChI | InChI=1S/C19H24N2O2/c1-4-21-10-12(19(22)23-3)8-15-13-6-5-7-16-18(13)14(9-17(15)21)11(2)20-16/h5-7,12,15,17,20H,4,8-10H2,1-3H3/t12-,15?,17+/m0/s1 |
| InChIKey | LXWZUHSYJQQCRU-CZZJGDGRSA-N |
| XLogP | 3.00 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |