C19H25N3S — CID 15069954
N-[(6aR,9S,10aR)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanethioamide (PubChem CID 15069954) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is N-[(6aR,9S,10aR)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanethioamide.
| Compound Name | N-[(6aR,9S,10aR)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanethioamide |
|---|---|
| PubChem CID | 15069954 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(6aR,9S,10aR)-5-methyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanethioamide |
| SMILES | CCCN1C[C@@H](NC=S)C[C@@H]2c3cccc4[nH]c(C)c(c34)C[C@H]21 |
| InChI | InChI=1S/C19H25N3S/c1-3-7-22-10-13(20-11-23)8-16-14-5-4-6-17-19(14)15(9-18(16)22)12(2)21-17/h4-6,11,13,16,18,21H,3,7-10H2,1-2H3,(H,20,23)/t13-,16+,18+/m0/s1 |
| InChIKey | QVXGGLZYKCDJEZ-FDQGKXFDSA-N |
| XLogP | 3.52 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|