C25H38N4O — CID 14723166
3-[(6aR,9S,10aR)-5-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 14723166) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-5-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S,10aR)-5-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 14723166 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 3-[(6aR,9S,10aR)-5-propan-2-yl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CC)C[C@@H]2c3cccc4[nH]c(C(C)C)c(c34)C[C@H]21 |
| InChI | InChI=1S/C25H38N4O/c1-6-12-29-15-17(26-25(30)28(7-2)8-3)13-19-18-10-9-11-21-23(18)20(14-22(19)29)24(27-21)16(4)5/h9-11,16-17,19,22,27H,6-8,12-15H2,1-5H3,(H,26,30)/t17-,19+,22+/m0/s1 |
| InChIKey | KOOLRJQIZRJAER-LRXVAGHRSA-N |
| XLogP | 4.84 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |