C23H32N4O2 — CID 70395041
3-[(6aR,9S)-7-methyl-5-propanoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 70395041) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-[(6aR,9S)-7-methyl-5-propanoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S)-7-methyl-5-propanoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 70395041 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 3-[(6aR,9S)-7-methyl-5-propanoyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCC(=O)c1[nH]c2cccc3c2c1C[C@@H]1C3C[C@H](NC(=O)N(CC)CC)CN1C |
| InChI | InChI=1S/C23H32N4O2/c1-5-20(28)22-17-12-19-16(15-9-8-10-18(25-22)21(15)17)11-14(13-26(19)4)24-23(29)27(6-2)7-3/h8-10,14,16,19,25H,5-7,11-13H2,1-4H3,(H,24,29)/t14-,16?,19+/m0/s1 |
| InChIKey | GDXZVZLCUNBZHK-BZELLKQSSA-N |
| XLogP | 3.52 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |