C23H32N4O — CID 129157321
3-(5-cyclopropyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-diethylurea (PubChem CID 129157321) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 3-(5-cyclopropyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-diethylurea.
| Compound Name | 3-(5-cyclopropyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 129157321 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 3-(5-cyclopropyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC1CC2c3cccc4[nH]c(C5CC5)c(c34)CC2N(C)C1 |
| InChI | InChI=1S/C23H32N4O/c1-4-27(5-2)23(28)24-15-11-17-16-7-6-8-19-21(16)18(12-20(17)26(3)13-15)22(25-19)14-9-10-14/h6-8,14-15,17,20,25H,4-5,9-13H2,1-3H3,(H,24,28) |
| InChIKey | ZUWSRUXQFHZIQE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |