C25H40N5O+ — CID 54057581
[(6aR,9S)-9-(diethylcarbamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]-diethyl-methylazanium (PubChem CID 54057581) has the molecular formula C25H40N5O+ and a molecular weight of 426.63 g/mol. Its IUPAC name is [(6aR,9S)-9-(diethylcarbamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]-diethyl-methylazanium.
| Compound Name | [(6aR,9S)-9-(diethylcarbamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]-diethyl-methylazanium |
|---|---|
| PubChem CID | 54057581 |
| Molecular Formula | C25H40N5O+ |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | [(6aR,9S)-9-(diethylcarbamoylamino)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-5-yl]-diethyl-methylazanium |
| SMILES | CCN(CC)C(=O)N[C@H]1CC2c3cccc4[nH]c([N+](C)(CC)CC)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C25H39N5O/c1-7-29(8-2)25(31)26-17-14-19-18-12-11-13-21-23(18)20(15-22(19)28(5)16-17)24(27-21)30(6,9-3)10-4/h11-13,17,19,22,27H,7-10,14-16H2,1-6H3/p+1/t17-,19?,22+/m0/s1 |
| InChIKey | LXIQVHHVTGPGLZ-JJKBQAIRSA-O |
| XLogP | 3.91 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|