C26H32N4O — CID 14653018
3-[(6aR,9S,10aR)-7-methyl-5-phenyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 14653018) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-7-methyl-5-phenyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S,10aR)-7-methyl-5-phenyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 14653018 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-[(6aR,9S,10aR)-7-methyl-5-phenyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1C[C@@H]2c3cccc4[nH]c(-c5ccccc5)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C26H32N4O/c1-4-30(5-2)26(31)27-18-14-20-19-12-9-13-22-24(19)21(15-23(20)29(3)16-18)25(28-22)17-10-7-6-8-11-17/h6-13,18,20,23,28H,4-5,14-16H2,1-3H3,(H,27,31)/t18-,20+,23+/m0/s1 |
| InChIKey | FAWAKAZTGYDXJY-JXHRLWIKSA-N |
| XLogP | 4.60 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |