C22H31N5O2 — CID 54533174
(6aR,9S)-9-(diethylcarbamoylamino)-N,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide (PubChem CID 54533174) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (6aR,9S)-9-(diethylcarbamoylamino)-N,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide.
| Compound Name | (6aR,9S)-9-(diethylcarbamoylamino)-N,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 54533174 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | (6aR,9S)-9-(diethylcarbamoylamino)-N,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide |
| SMILES | CCN(CC)C(=O)N[C@H]1CC2c3cccc4[nH]c(C(=O)NC)c(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C22H31N5O2/c1-5-27(6-2)22(29)24-13-10-15-14-8-7-9-17-19(14)16(11-18(15)26(4)12-13)20(25-17)21(28)23-3/h7-9,13,15,18,25H,5-6,10-12H2,1-4H3,(H,23,28)(H,24,29)/t13-,15?,18+/m0/s1 |
| InChIKey | YXYKPDXVEJNYHY-PLXAZLAVSA-N |
| XLogP | 2.29 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |