C24H35ClN4O2 — CID 67788360
3-[(6aR,9S)-5-chloro-2-(1-hydroxyethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 67788360) has the molecular formula C24H35ClN4O2 and a molecular weight of 447.02 g/mol. Its IUPAC name is 3-[(6aR,9S)-5-chloro-2-(1-hydroxyethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S)-5-chloro-2-(1-hydroxyethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 67788360 |
| Molecular Formula | C24H35ClN4O2 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 3-[(6aR,9S)-5-chloro-2-(1-hydroxyethyl)-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CC)CC2c3cc(C(C)O)cc4[nH]c(Cl)c(c34)C[C@H]21 |
| InChI | InChI=1S/C24H35ClN4O2/c1-5-8-29-13-16(26-24(31)28(6-2)7-3)11-17-18-9-15(14(4)30)10-20-22(18)19(12-21(17)29)23(25)27-20/h9-10,14,16-17,21,27,30H,5-8,11-13H2,1-4H3,(H,26,31)/t14?,16-,17?,21+/m0/s1 |
| InChIKey | WKKJVZYMKJYLSK-SQVIXKHGSA-N |
| XLogP | 4.42 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |