C23H34N4OS — CID 67938203
3-[(6aR,9S)-2-methylsulfanyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 67938203) has the molecular formula C23H34N4OS and a molecular weight of 414.62 g/mol. Its IUPAC name is 3-[(6aR,9S)-2-methylsulfanyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S)-2-methylsulfanyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 67938203 |
| Molecular Formula | C23H34N4OS |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 3-[(6aR,9S)-2-methylsulfanyl-7-propyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCCN1C[C@@H](NC(=O)N(CC)CC)CC2c3cc(SC)cc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C23H34N4OS/c1-5-8-27-14-16(25-23(28)26(6-2)7-3)10-18-19-11-17(29-4)12-20-22(19)15(13-24-20)9-21(18)27/h11-13,16,18,21,24H,5-10,14H2,1-4H3,(H,25,28)/t16-,18?,21+/m0/s1 |
| InChIKey | BNRWFOBDZDHYCM-QSCSDJCXSA-N |
| XLogP | 4.43 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |